C18H27N7O4 — CID 155698907
N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(2-methylpyrimidin-5-yl)oxy-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide (PubChem CID 155698907) has the molecular formula C18H27N7O4 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(2-methylpyrimidin-5-yl)oxy-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide.
| Compound Name | N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(2-methylpyrimidin-5-yl)oxy-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 155698907 |
| Molecular Formula | C18H27N7O4 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(2-methylpyrimidin-5-yl)oxy-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)NC(CCC/N=C(\N)NC#N)C(=O)COc1cnc(C)nc1 |
| InChI | InChI=1S/C18H27N7O4/c1-12-22-8-13(9-23-12)29-10-15(26)14(25-16(27)18(2,3)28-4)6-5-7-21-17(20)24-11-19/h8-9,14H,5-7,10H2,1-4H3,(H,25,27)(H3,20,21,24) |
| InChIKey | CLHVGFADOQXTEJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|