C16H23F6N5O4 — CID 155128789
N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide (PubChem CID 155128789) has the molecular formula C16H23F6N5O4 and a molecular weight of 463.38 g/mol. Its IUPAC name is N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide.
| Compound Name | N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 155128789 |
| Molecular Formula | C16H23F6N5O4 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)NC(CCC/N=C(\N)NC#N)C(=O)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H23F6N5O4/c1-14(2,30-3)12(29)27-9(5-4-6-25-13(24)26-8-23)10(28)7-31-11(15(17,18)19)16(20,21)22/h9,11H,4-7H2,1-3H3,(H,27,29)(H3,24,25,26) |
| InChIKey | RJFVCALQBSJAFV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|