C14H21F6N5O4 — CID 155698909
2-acetamido-N-[6-(diaminomethylideneamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]acetamide (PubChem CID 155698909) has the molecular formula C14H21F6N5O4 and a molecular weight of 437.34 g/mol. Its IUPAC name is 2-acetamido-N-[6-(diaminomethylideneamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]acetamide.
| Compound Name | 2-acetamido-N-[6-(diaminomethylideneamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]acetamide |
|---|---|
| PubChem CID | 155698909 |
| Molecular Formula | C14H21F6N5O4 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-acetamido-N-[6-(diaminomethylideneamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]acetamide |
| SMILES | CC(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H21F6N5O4/c1-7(26)24-5-10(28)25-8(3-2-4-23-12(21)22)9(27)6-29-11(13(15,16)17)14(18,19)20/h8,11H,2-6H2,1H3,(H,24,26)(H,25,28)(H4,21,22,23) |
| InChIKey | LVMQDTWPUGXHEH-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|