C16H19F6N5O3 — CID 155128782
N-[6-(diaminomethylideneamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]pyridine-3-carboxamide (PubChem CID 155128782) has the molecular formula C16H19F6N5O3 and a molecular weight of 443.35 g/mol. Its IUPAC name is N-[6-(diaminomethylideneamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[6-(diaminomethylideneamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155128782 |
| Molecular Formula | C16H19F6N5O3 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[6-(diaminomethylideneamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]pyridine-3-carboxamide |
| SMILES | NC(N)=NCCCC(NC(=O)c1cccnc1)C(=O)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H19F6N5O3/c17-15(18,19)13(16(20,21)22)30-8-11(28)10(4-2-6-26-14(23)24)27-12(29)9-3-1-5-25-7-9/h1,3,5,7,10,13H,2,4,6,8H2,(H,27,29)(H4,23,24,26) |
| InChIKey | JLYXIZGWAJCBFC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|