C21H34FN5O4 — CID 155698923
N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(3-fluorophenoxy)-2-hydroxyhexan-3-yl]-2-methoxy-2-methylpropanamide;ethane (PubChem CID 155698923) has the molecular formula C21H34FN5O4 and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(3-fluorophenoxy)-2-hydroxyhexan-3-yl]-2-methoxy-2-methylpropanamide;ethane.
| Compound Name | N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(3-fluorophenoxy)-2-hydroxyhexan-3-yl]-2-methoxy-2-methylpropanamide;ethane |
|---|---|
| PubChem CID | 155698923 |
| Molecular Formula | C21H34FN5O4 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(3-fluorophenoxy)-2-hydroxyhexan-3-yl]-2-methoxy-2-methylpropanamide;ethane |
| SMILES | CC.COC(C)(C)C(=O)NC(CCC/N=C(\N)NC#N)C(O)COc1cccc(F)c1 |
| InChI | InChI=1S/C19H28FN5O4.C2H6/c1-19(2,28-3)17(27)25-15(8-5-9-23-18(22)24-12-21)16(26)11-29-14-7-4-6-13(20)10-14;1-2/h4,6-7,10,15-16,26H,5,8-9,11H2,1-3H3,(H,25,27)(H3,22,23,24);1-2H3 |
| InChIKey | LWJVEWMFWJQVHQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|