C10H13FO3 — CID 117236747
4-(3-fluorophenoxy)butane-1,3-diol (PubChem CID 117236747) has the molecular formula C10H13FO3 and a molecular weight of 200.21 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)butane-1,3-diol.
| Compound Name | 4-(3-fluorophenoxy)butane-1,3-diol |
|---|---|
| PubChem CID | 117236747 |
| Molecular Formula | C10H13FO3 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 4-(3-fluorophenoxy)butane-1,3-diol |
| SMILES | OCCC(O)COc1cccc(F)c1 |
| InChI | InChI=1S/C10H13FO3/c11-8-2-1-3-10(6-8)14-7-9(13)4-5-12/h1-3,6,9,12-13H,4-5,7H2 |
| InChIKey | CJXZAPMSBLWOLM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |