C19H31N5O4 — CID 155128785
N-[(3S)-6-(diaminomethylideneamino)-1-[(2,6-dimethyl-4-pyridinyl)oxy]-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide (PubChem CID 155128785) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(3S)-6-(diaminomethylideneamino)-1-[(2,6-dimethyl-4-pyridinyl)oxy]-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide.
| Compound Name | N-[(3S)-6-(diaminomethylideneamino)-1-[(2,6-dimethyl-4-pyridinyl)oxy]-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 155128785 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-[(3S)-6-(diaminomethylideneamino)-1-[(2,6-dimethyl-4-pyridinyl)oxy]-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)COc1cc(C)nc(C)c1 |
| InChI | InChI=1S/C19H31N5O4/c1-12-9-14(10-13(2)23-12)28-11-16(25)15(7-6-8-22-18(20)21)24-17(26)19(3,4)27-5/h9-10,15H,6-8,11H2,1-5H3,(H,24,26)(H4,20,21,22)/t15-/m0/s1 |
| InChIKey | ZUMDMJCDLDQTMZ-HNNXBMFYSA-N |
| XLogP | 0.61 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|