C24H39N3O6 — CID 134356816
tert-butyl N-[(5S)-7-[(2,6-dimethyl-4-pyridinyl)oxy]-5-[(2-methoxy-2-methylpropanoyl)amino]-6-oxoheptyl]carbamate (PubChem CID 134356816) has the molecular formula C24H39N3O6 and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl N-[(5S)-7-[(2,6-dimethyl-4-pyridinyl)oxy]-5-[(2-methoxy-2-methylpropanoyl)amino]-6-oxoheptyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-7-[(2,6-dimethyl-4-pyridinyl)oxy]-5-[(2-methoxy-2-methylpropanoyl)amino]-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 134356816 |
| Molecular Formula | C24H39N3O6 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | tert-butyl N-[(5S)-7-[(2,6-dimethyl-4-pyridinyl)oxy]-5-[(2-methoxy-2-methylpropanoyl)amino]-6-oxoheptyl]carbamate |
| SMILES | COC(C)(C)C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)COc1cc(C)nc(C)c1 |
| InChI | InChI=1S/C24H39N3O6/c1-16-13-18(14-17(2)26-16)32-15-20(28)19(27-21(29)24(6,7)31-8)11-9-10-12-25-22(30)33-23(3,4)5/h13-14,19H,9-12,15H2,1-8H3,(H,25,30)(H,27,29)/t19-/m0/s1 |
| InChIKey | MZAWHFLAKGFKGQ-IBGZPJMESA-N |
| XLogP | 3.25 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|