C39H64N4O13 — CID 172728689
[4-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyloxy]-3-methoxyphenyl] 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 172728689) has the molecular formula C39H64N4O13 and a molecular weight of 796.96 g/mol. Its IUPAC name is [4-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyloxy]-3-methoxyphenyl] 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | [4-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyloxy]-3-methoxyphenyl] 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 172728689 |
| Molecular Formula | C39H64N4O13 |
| Molecular Weight | 796.96 g/mol |
| Exact Mass | 796.45 |
| IUPAC Name | [4-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyloxy]-3-methoxyphenyl] 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COc1cc(OC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)ccc1OC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H64N4O13/c1-36(2,3)53-32(46)40-22-16-14-18-26(42-34(48)55-38(7,8)9)30(44)51-25-20-21-28(29(24-25)50-13)52-31(45)27(43-35(49)56-39(10,11)12)19-15-17-23-41-33(47)54-37(4,5)6/h20-21,24,26-27H,14-19,22-23H2,1-13H3,(H,40,46)(H,41,47)(H,42,48)(H,43,49) |
| InChIKey | HMNZKGJHTDYSTH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 215.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.96 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|