C24H30N2O6 — CID 68894907
[8-[(2-methylpropan-2-yl)oxycarbonylamino]-1-naphthalen-2-yl-1,3-dioxooctan-4-yl]carbamic acid (PubChem CID 68894907) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is [8-[(2-methylpropan-2-yl)oxycarbonylamino]-1-naphthalen-2-yl-1,3-dioxooctan-4-yl]carbamic acid.
| Compound Name | [8-[(2-methylpropan-2-yl)oxycarbonylamino]-1-naphthalen-2-yl-1,3-dioxooctan-4-yl]carbamic acid |
|---|---|
| PubChem CID | 68894907 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [8-[(2-methylpropan-2-yl)oxycarbonylamino]-1-naphthalen-2-yl-1,3-dioxooctan-4-yl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)O)C(=O)CC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H30N2O6/c1-24(2,3)32-23(31)25-13-7-6-10-19(26-22(29)30)21(28)15-20(27)18-12-11-16-8-4-5-9-17(16)14-18/h4-5,8-9,11-12,14,19,26H,6-7,10,13,15H2,1-3H3,(H,25,31)(H,29,30) |
| InChIKey | PDUDWZNWEPGFDK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|