C23H29F6IN5O8- — CID 155698913
[4-[iodosyl(oxido)amino]phenyl]methyl N-[N'-[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-[(2-methoxy-2-methylpropanoyl)amino]-5-oxohexyl]carbamimidoyl]carbamate (PubChem CID 155698913) has the molecular formula C23H29F6IN5O8- and a molecular weight of 744.40 g/mol. Its IUPAC name is [4-[iodosyl(oxido)amino]phenyl]methyl N-[N'-[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-[(2-methoxy-2-methylpropanoyl)amino]-5-oxohexyl]carbamimidoyl]carbamate.
| Compound Name | [4-[iodosyl(oxido)amino]phenyl]methyl N-[N'-[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-[(2-methoxy-2-methylpropanoyl)amino]-5-oxohexyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 155698913 |
| Molecular Formula | C23H29F6IN5O8- |
| Molecular Weight | 744.40 g/mol |
| Exact Mass | 744.10 |
| IUPAC Name | [4-[iodosyl(oxido)amino]phenyl]methyl N-[N'-[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-[(2-methoxy-2-methylpropanoyl)amino]-5-oxohexyl]carbamimidoyl]carbamate |
| SMILES | COC(C)(C)C(=O)NC(CCC/N=C(\N)NC(=O)OCc1ccc(N([O-])I=O)cc1)C(=O)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H29F6IN5O8/c1-21(2,41-3)18(37)33-15(16(36)12-42-17(22(24,25)26)23(27,28)29)5-4-10-32-19(31)34-20(38)43-11-13-6-8-14(9-7-13)35(40)30-39/h6-9,15,17H,4-5,10-12H2,1-3H3,(H,33,37)(H3,31,32,34,38)/q-1 |
| InChIKey | ACYNDSYKNNEMKX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 184.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|