C15H26F6N4O4 — CID 155140249
N-[(3S)-6-(diaminomethylamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide (PubChem CID 155140249) has the molecular formula C15H26F6N4O4 and a molecular weight of 440.39 g/mol. Its IUPAC name is N-[(3S)-6-(diaminomethylamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide.
| Compound Name | N-[(3S)-6-(diaminomethylamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 155140249 |
| Molecular Formula | C15H26F6N4O4 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[(3S)-6-(diaminomethylamino)-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)N[C@@H](CCCNC(N)N)C(=O)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H26F6N4O4/c1-13(2,28-3)11(27)25-8(5-4-6-24-12(22)23)9(26)7-29-10(14(16,17)18)15(19,20)21/h8,10,12,24H,4-7,22-23H2,1-3H3,(H,25,27)/t8-/m0/s1 |
| InChIKey | VQVDQGAXLPDYCW-QMMMGPOBSA-N |
| XLogP | 0.55 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|