C7H18N4O2 — CID 134576168
5-(diaminomethylamino)-2-(methylamino)pentanoic acid (PubChem CID 134576168) has the molecular formula C7H18N4O2 and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-(diaminomethylamino)-2-(methylamino)pentanoic acid.
| Compound Name | 5-(diaminomethylamino)-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 134576168 |
| Molecular Formula | C7H18N4O2 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 5-(diaminomethylamino)-2-(methylamino)pentanoic acid |
| SMILES | CNC(CCCNC(N)N)C(=O)O |
| InChI | InChI=1S/C7H18N4O2/c1-10-5(6(12)13)3-2-4-11-7(8)9/h5,7,10-11H,2-4,8-9H2,1H3,(H,12,13) |
| InChIKey | JSMIHHZTQYCUHZ-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|