C14H29N3O3 — CID 172626078
(2S)-6-[(2-amino-4,4-dimethylpentanoyl)amino]-2-(methylamino)hexanoic acid (PubChem CID 172626078) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2S)-6-[(2-amino-4,4-dimethylpentanoyl)amino]-2-(methylamino)hexanoic acid.
| Compound Name | (2S)-6-[(2-amino-4,4-dimethylpentanoyl)amino]-2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 172626078 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2S)-6-[(2-amino-4,4-dimethylpentanoyl)amino]-2-(methylamino)hexanoic acid |
| SMILES | CN[C@@H](CCCCNC(=O)C(N)CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H29N3O3/c1-14(2,3)9-10(15)12(18)17-8-6-5-7-11(16-4)13(19)20/h10-11,16H,5-9,15H2,1-4H3,(H,17,18)(H,19,20)/t10?,11-/m0/s1 |
| InChIKey | HIQUOFXXRVFDJN-DTIOYNMSSA-N |
| XLogP | 0.71 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|