C17H36N4O3 — CID 58587429
6-[2,6-bis(dimethylamino)hexanoylamino]-2-(methylamino)hexanoic acid (PubChem CID 58587429) has the molecular formula C17H36N4O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 6-[2,6-bis(dimethylamino)hexanoylamino]-2-(methylamino)hexanoic acid.
| Compound Name | 6-[2,6-bis(dimethylamino)hexanoylamino]-2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 58587429 |
| Molecular Formula | C17H36N4O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | 6-[2,6-bis(dimethylamino)hexanoylamino]-2-(methylamino)hexanoic acid |
| SMILES | CNC(CCCCNC(=O)C(CCCCN(C)C)N(C)C)C(=O)O |
| InChI | InChI=1S/C17H36N4O3/c1-18-14(17(23)24)10-6-8-12-19-16(22)15(21(4)5)11-7-9-13-20(2)3/h14-15,18H,6-13H2,1-5H3,(H,19,22)(H,23,24) |
| InChIKey | VKOLJJHHAVAEOB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|