C13H27N3O4 — CID 157202604
acetic acid;6-(acetylamino)-2-(dimethylamino)-N-(113C)methylhexan(15N)amide (PubChem CID 157202604) has the molecular formula C13H27N3O4 and a molecular weight of 294.34 g/mol. Its IUPAC name is acetic acid;6-(acetylamino)-2-(dimethylamino)-N-(113C)methylhexan(15N)amide.
| Compound Name | acetic acid;6-(acetylamino)-2-(dimethylamino)-N-(113C)methylhexan(15N)amide |
|---|---|
| PubChem CID | 157202604 |
| Molecular Formula | C13H27N3O4 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | acetic acid;6-(acetylamino)-2-(dimethylamino)-N-(113C)methylhexan(15N)amide |
| SMILES | C[15N](C)C(CCCCNC([13CH3])=O)C(=O)[15NH][13CH3].[13CH3]C(=O)O |
| InChI | InChI=1S/C11H23N3O2.C2H4O2/c1-9(15)13-8-6-5-7-10(14(3)4)11(16)12-2;1-2(3)4/h10H,5-8H2,1-4H3,(H,12,16)(H,13,15);1H3,(H,3,4)/i1+1,2+1,12+1,14+1;1+1 |
| InChIKey | CPDCPKLEXOHWFS-BNYLBQBDSA-N |
| XLogP | 0.06 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|