C21H23ClN2O4 — CID 7836469
2-(4-chlorophenoxy)ethyl 1-(phenylcarbamoyl)piperidine-4-carboxylate (PubChem CID 7836469) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 1-(phenylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 1-(phenylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7836469 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 1-(phenylcarbamoyl)piperidine-4-carboxylate |
| SMILES | O=C(OCCOc1ccc(Cl)cc1)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23ClN2O4/c22-17-6-8-19(9-7-17)27-14-15-28-20(25)16-10-12-24(13-11-16)21(26)23-18-4-2-1-3-5-18/h1-9,16H,10-15H2,(H,23,26) |
| InChIKey | ULGHDOXJRCVHOZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|