C23H23N3O5 — CID 7836697
2-(1,3-dioxoisoindol-2-yl)ethyl 1-(phenylcarbamoyl)piperidine-4-carboxylate (PubChem CID 7836697) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(phenylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(phenylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7836697 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(phenylcarbamoyl)piperidine-4-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C23H23N3O5/c27-20-18-8-4-5-9-19(18)21(28)26(20)14-15-31-22(29)16-10-12-25(13-11-16)23(30)24-17-6-2-1-3-7-17/h1-9,16H,10-15H2,(H,24,30) |
| InChIKey | SBHUHHPBXWNWQM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|