C17H19N3O5 — CID 108874824
1-[2-(1,3-dioxoisoindol-2-yl)ethylcarbamoyl]piperidine-4-carboxylic acid (PubChem CID 108874824) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethylcarbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethylcarbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 108874824 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethylcarbamoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)NCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C17H19N3O5/c21-14-12-3-1-2-4-13(12)15(22)20(14)10-7-18-17(25)19-8-5-11(6-9-19)16(23)24/h1-4,11H,5-10H2,(H,18,25)(H,23,24) |
| InChIKey | FMHIAAANBMGFKN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|