C25H28N2O6S — CID 41150714
2-(1,3-dioxoisoindol-2-yl)ethyl 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 41150714) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 41150714 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(C(=O)OCCN3C(=O)c4ccccc4C3=O)CC2)c(C)c1 |
| InChI | InChI=1S/C25H28N2O6S/c1-16-14-17(2)22(18(3)15-16)34(31,32)26-10-8-19(9-11-26)25(30)33-13-12-27-23(28)20-6-4-5-7-21(20)24(27)29/h4-7,14-15,19H,8-13H2,1-3H3 |
| InChIKey | OZGICQQMRRWUKJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|