C22H25N3O7S — CID 55463024
3-(1,3-dioxoisoindol-2-yl)propyl 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-3-carboxylate (PubChem CID 55463024) has the molecular formula C22H25N3O7S and a molecular weight of 475.52 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-3-carboxylate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55463024 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-3-carboxylate |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCC(C(=O)OCCCN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C22H25N3O7S/c1-14-19(15(2)32-23-14)33(29,30)24-10-5-7-16(13-24)22(28)31-12-6-11-25-20(26)17-8-3-4-9-18(17)21(25)27/h3-4,8-9,16H,5-7,10-13H2,1-2H3 |
| InChIKey | AGLIXZFFSCWTIZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 127.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|