C15H21N3O5S — CID 43056507
3-cyanopropyl 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carboxylate (PubChem CID 43056507) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-cyanopropyl 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carboxylate.
| Compound Name | 3-cyanopropyl 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43056507 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-cyanopropyl 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carboxylate |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC(C(=O)OCCCC#N)CC1 |
| InChI | InChI=1S/C15H21N3O5S/c1-11-14(12(2)23-17-11)24(20,21)18-8-5-13(6-9-18)15(19)22-10-4-3-7-16/h13H,3-6,8-10H2,1-2H3 |
| InChIKey | GXFJRSYBMPKVQQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 113.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|