C11H19N3O4S — CID 39392885
O-[[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]methyl]hydroxylamine (PubChem CID 39392885) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is O-[[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]methyl]hydroxylamine.
| Compound Name | O-[[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 39392885 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | O-[[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]methyl]hydroxylamine |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC(CON)CC1 |
| InChI | InChI=1S/C11H19N3O4S/c1-8-11(9(2)18-13-8)19(15,16)14-5-3-10(4-6-14)7-17-12/h10H,3-7,12H2,1-2H3 |
| InChIKey | PTEYMQSEACDAFC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|