C17H19FN2O5S — CID 18288018
(4-fluorophenyl) 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carboxylate (PubChem CID 18288018) has the molecular formula C17H19FN2O5S and a molecular weight of 382.41 g/mol. Its IUPAC name is (4-fluorophenyl) 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carboxylate.
| Compound Name | (4-fluorophenyl) 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18288018 |
| Molecular Formula | C17H19FN2O5S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (4-fluorophenyl) 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carboxylate |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC(C(=O)Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H19FN2O5S/c1-11-16(12(2)25-19-11)26(22,23)20-9-7-13(8-10-20)17(21)24-15-5-3-14(18)4-6-15/h3-6,13H,7-10H2,1-2H3 |
| InChIKey | FHGUWDQFPAXBTO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|