C24H26N2O6S — CID 97070813
2-(1,3-dioxoisoindol-2-yl)ethyl 2-methyl-5-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 97070813) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-methyl-5-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-methyl-5-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 97070813 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-methyl-5-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2C)cc1C(=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H26N2O6S/c1-16-10-11-18(33(30,31)26-12-6-5-7-17(26)2)15-21(16)24(29)32-14-13-25-22(27)19-8-3-4-9-20(19)23(25)28/h3-4,8-11,15,17H,5-7,12-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | FXOKUZCGUHBZIM-KRWDZBQOSA-N |
| XLogP | 3.01 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|