C20H30N2O5S — CID 46624379
[1-oxo-1-(propylamino)propan-2-yl] 2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 46624379) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is [1-oxo-1-(propylamino)propan-2-yl] 2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [1-oxo-1-(propylamino)propan-2-yl] 2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 46624379 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [1-oxo-1-(propylamino)propan-2-yl] 2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CCCNC(=O)C(C)OC(=O)c1cc(S(=O)(=O)N2CCCCC2C)ccc1C |
| InChI | InChI=1S/C20H30N2O5S/c1-5-11-21-19(23)16(4)27-20(24)18-13-17(10-9-14(18)2)28(25,26)22-12-7-6-8-15(22)3/h9-10,13,15-16H,5-8,11-12H2,1-4H3,(H,21,23) |
| InChIKey | AYAXWTGAPQILDP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |