C17H24N2O5S — CID 55320484
(1-amino-1-oxopropan-2-yl) 2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 55320484) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 55320484 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2C)cc1C(=O)OC(C)C(N)=O |
| InChI | InChI=1S/C17H24N2O5S/c1-11-7-8-14(10-15(11)17(21)24-13(3)16(18)20)25(22,23)19-9-5-4-6-12(19)2/h7-8,10,12-13H,4-6,9H2,1-3H3,(H2,18,20) |
| InChIKey | UCCRZWMFWNPVCU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |