C29H38N4O5S — CID 44555889
N-benzyl-N-(cyclohexylmethoxy)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]hexane-1-sulfonamide (PubChem CID 44555889) has the molecular formula C29H38N4O5S and a molecular weight of 554.71 g/mol. Its IUPAC name is N-benzyl-N-(cyclohexylmethoxy)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]hexane-1-sulfonamide.
| Compound Name | N-benzyl-N-(cyclohexylmethoxy)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]hexane-1-sulfonamide |
|---|---|
| PubChem CID | 44555889 |
| Molecular Formula | C29H38N4O5S |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | N-benzyl-N-(cyclohexylmethoxy)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]hexane-1-sulfonamide |
| SMILES | O=c1c(NCCCCCCS(=O)(=O)N(Cc2ccccc2)OCC2CCCCC2)c(Nc2ccncc2)c1=O |
| InChI | InChI=1S/C29H38N4O5S/c34-28-26(27(29(28)35)32-25-15-18-30-19-16-25)31-17-9-1-2-10-20-39(36,37)33(21-23-11-5-3-6-12-23)38-22-24-13-7-4-8-14-24/h3,5-6,11-12,15-16,18-19,24,31H,1-2,4,7-10,13-14,17,20-22H2,(H,30,32) |
| InChIKey | VWTBSHQNRUBPQM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|