C15H11N3O2 — CID 139778461
3-anilino-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 139778461) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-anilino-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-anilino-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 139778461 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-anilino-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2ccccc2)c(Nc2ccncc2)c1=O |
| InChI | InChI=1S/C15H11N3O2/c19-14-12(17-10-4-2-1-3-5-10)13(15(14)20)18-11-6-8-16-9-7-11/h1-9,17H,(H,16,18) |
| InChIKey | GFKGTCMXOFDCDK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|