C16H14N4O2 — CID 87660171
3-(pyridin-4-ylamino)-4-(2-pyridin-4-ylethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 87660171) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-(pyridin-4-ylamino)-4-(2-pyridin-4-ylethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(pyridin-4-ylamino)-4-(2-pyridin-4-ylethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87660171 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-(pyridin-4-ylamino)-4-(2-pyridin-4-ylethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCc2ccncc2)c(Nc2ccncc2)c1=O |
| InChI | InChI=1S/C16H14N4O2/c21-15-13(19-10-3-11-1-6-17-7-2-11)14(16(15)22)20-12-4-8-18-9-5-12/h1-2,4-9,19H,3,10H2,(H,18,20) |
| InChIKey | ZUTUPRSWJDPHPC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|