C19H18N4O3 — CID 87660609
N-[3-[2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]ethyl]phenyl]acetamide (PubChem CID 87660609) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[3-[2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 87660609 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[3-[2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CCNc2c(Nc3ccncc3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C19H18N4O3/c1-12(24)22-15-4-2-3-13(11-15)5-10-21-16-17(19(26)18(16)25)23-14-6-8-20-9-7-14/h2-4,6-9,11,21H,5,10H2,1H3,(H,20,23)(H,22,24) |
| InChIKey | AGJJBTOSUHFKRS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|