C18H14ClFN2O2 — CID 170609376
3-(4-chloroanilino)-4-[2-(3-fluorophenyl)ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 170609376) has the molecular formula C18H14ClFN2O2 and a molecular weight of 344.77 g/mol. Its IUPAC name is 3-(4-chloroanilino)-4-[2-(3-fluorophenyl)ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chloroanilino)-4-[2-(3-fluorophenyl)ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 170609376 |
| Molecular Formula | C18H14ClFN2O2 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 3-(4-chloroanilino)-4-[2-(3-fluorophenyl)ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCc2cccc(F)c2)c(Nc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C18H14ClFN2O2/c19-12-4-6-14(7-5-12)22-16-15(17(23)18(16)24)21-9-8-11-2-1-3-13(20)10-11/h1-7,10,21-22H,8-9H2 |
| InChIKey | STVHTXVRTACVST-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|