C19H16ClN5O2 — CID 57475513
3-[(3-amino-1H-indazol-5-yl)amino]-4-[2-(3-chlorophenyl)ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 57475513) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 3-[(3-amino-1H-indazol-5-yl)amino]-4-[2-(3-chlorophenyl)ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(3-amino-1H-indazol-5-yl)amino]-4-[2-(3-chlorophenyl)ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 57475513 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-[(3-amino-1H-indazol-5-yl)amino]-4-[2-(3-chlorophenyl)ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1n[nH]c2ccc(Nc3c(NCCc4cccc(Cl)c4)c(=O)c3=O)cc12 |
| InChI | InChI=1S/C19H16ClN5O2/c20-11-3-1-2-10(8-11)6-7-22-15-16(18(27)17(15)26)23-12-4-5-14-13(9-12)19(21)25-24-14/h1-5,8-9,22-23H,6-7H2,(H3,21,24,25) |
| InChIKey | QQEVKTFEKUWHCK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|