C19H16N4O3 — CID 123529694
3-[2-(3-hydroxyphenyl)ethylamino]-4-(1H-indazol-5-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 123529694) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-[2-(3-hydroxyphenyl)ethylamino]-4-(1H-indazol-5-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[2-(3-hydroxyphenyl)ethylamino]-4-(1H-indazol-5-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 123529694 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-[2-(3-hydroxyphenyl)ethylamino]-4-(1H-indazol-5-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCc2cccc(O)c2)c(Nc2ccc3[nH]ncc3c2)c1=O |
| InChI | InChI=1S/C19H16N4O3/c24-14-3-1-2-11(8-14)6-7-20-16-17(19(26)18(16)25)22-13-4-5-15-12(9-13)10-21-23-15/h1-5,8-10,20,22,24H,6-7H2,(H,21,23) |
| InChIKey | CAHKLSVIGROLFL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|