C20H16N4O4 — CID 87749704
3-[(3-hydroxyphenyl)methylamino]-4-(4-hydroxy-3-pyrazol-1-ylanilino)cyclobut-3-ene-1,2-dione (PubChem CID 87749704) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is 3-[(3-hydroxyphenyl)methylamino]-4-(4-hydroxy-3-pyrazol-1-ylanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(3-hydroxyphenyl)methylamino]-4-(4-hydroxy-3-pyrazol-1-ylanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87749704 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-[(3-hydroxyphenyl)methylamino]-4-(4-hydroxy-3-pyrazol-1-ylanilino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2cccc(O)c2)c(Nc2ccc(O)c(-n3cccn3)c2)c1=O |
| InChI | InChI=1S/C20H16N4O4/c25-14-4-1-3-12(9-14)11-21-17-18(20(28)19(17)27)23-13-5-6-16(26)15(10-13)24-8-2-7-22-24/h1-10,21,23,25-26H,11H2 |
| InChIKey | HIERIUZMYLYUJL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|