C15H13F2N3 — CID 115526186
N-[[3-(difluoromethyl)phenyl]methyl]-1H-indazol-5-amine (PubChem CID 115526186) has the molecular formula C15H13F2N3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-1H-indazol-5-amine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 115526186 |
| Molecular Formula | C15H13F2N3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-1H-indazol-5-amine |
| SMILES | FC(F)c1cccc(CNc2ccc3[nH]ncc3c2)c1 |
| InChI | InChI=1S/C15H13F2N3/c16-15(17)11-3-1-2-10(6-11)8-18-13-4-5-14-12(7-13)9-19-20-14/h1-7,9,15,18H,8H2,(H,19,20) |
| InChIKey | NNNZPCIVNVMSNF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |