C19H17ClN2O2 — CID 170609362
3-(4-chloroanilino)-4-(3-phenylpropylamino)cyclobut-3-ene-1,2-dione (PubChem CID 170609362) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is 3-(4-chloroanilino)-4-(3-phenylpropylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chloroanilino)-4-(3-phenylpropylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 170609362 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(4-chloroanilino)-4-(3-phenylpropylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCCc2ccccc2)c(Nc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C19H17ClN2O2/c20-14-8-10-15(11-9-14)22-17-16(18(23)19(17)24)21-12-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-11,21-22H,4,7,12H2 |
| InChIKey | LXVLUSRWNKIOAA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|