C15H14N4O2 — CID 87658273
3-(2-phenylethylamino)-4-(1H-pyrazol-5-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 87658273) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-(2-phenylethylamino)-4-(1H-pyrazol-5-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2-phenylethylamino)-4-(1H-pyrazol-5-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87658273 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-(2-phenylethylamino)-4-(1H-pyrazol-5-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCc2ccccc2)c(Nc2ccn[nH]2)c1=O |
| InChI | InChI=1S/C15H14N4O2/c20-14-12(16-8-6-10-4-2-1-3-5-10)13(15(14)21)18-11-7-9-17-19-11/h1-5,7,9,16H,6,8H2,(H2,17,18,19) |
| InChIKey | RUWADOWNRHAYBH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|