C10H6FNO3 — CID 142171537
(2-anilino-3,4-dioxocyclobuten-1-yl) hypofluorite (PubChem CID 142171537) has the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. Its IUPAC name is (2-anilino-3,4-dioxocyclobuten-1-yl) hypofluorite.
| Compound Name | (2-anilino-3,4-dioxocyclobuten-1-yl) hypofluorite |
|---|---|
| PubChem CID | 142171537 |
| Molecular Formula | C10H6FNO3 |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | (2-anilino-3,4-dioxocyclobuten-1-yl) hypofluorite |
| SMILES | O=c1c(Nc2ccccc2)c(OF)c1=O |
| InChI | InChI=1S/C10H6FNO3/c11-15-10-7(8(13)9(10)14)12-6-4-2-1-3-5-6/h1-5,12H |
| InChIKey | CHYGIVRZRZWKBH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|