C27H37N5O10S — CID 118000635
2-[cyclohexyl-[6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-2-morpholin-4-yloxyhexyl]sulfonylamino]oxy-2-oxoacetic acid (PubChem CID 118000635) has the molecular formula C27H37N5O10S and a molecular weight of 623.69 g/mol. Its IUPAC name is 2-[cyclohexyl-[6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-2-morpholin-4-yloxyhexyl]sulfonylamino]oxy-2-oxoacetic acid.
| Compound Name | 2-[cyclohexyl-[6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-2-morpholin-4-yloxyhexyl]sulfonylamino]oxy-2-oxoacetic acid |
|---|---|
| PubChem CID | 118000635 |
| Molecular Formula | C27H37N5O10S |
| Molecular Weight | 623.69 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 2-[cyclohexyl-[6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-2-morpholin-4-yloxyhexyl]sulfonylamino]oxy-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)ON(C1CCCCC1)S(=O)(=O)CC(CCCCNc1c(Nc2ccncc2)c(=O)c1=O)ON1CCOCC1 |
| InChI | InChI=1S/C27H37N5O10S/c33-24-22(23(25(24)34)30-19-9-12-28-13-10-19)29-11-5-4-8-21(41-31-14-16-40-17-15-31)18-43(38,39)32(42-27(37)26(35)36)20-6-2-1-3-7-20/h9-10,12-13,20-21,29H,1-8,11,14-18H2,(H,28,30)(H,35,36) |
| InChIKey | DPRIFEPKRPSOJT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 193.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.69 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|