C23H35N4O4P — CID 44556140
3-[6-[(cyclohexylamino)-ethoxyphosphoryl]hexylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 44556140) has the molecular formula C23H35N4O4P and a molecular weight of 462.53 g/mol. Its IUPAC name is 3-[6-[(cyclohexylamino)-ethoxyphosphoryl]hexylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[6-[(cyclohexylamino)-ethoxyphosphoryl]hexylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 44556140 |
| Molecular Formula | C23H35N4O4P |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3-[6-[(cyclohexylamino)-ethoxyphosphoryl]hexylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCOP(=O)(CCCCCCNc1c(Nc2ccncc2)c(=O)c1=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H35N4O4P/c1-2-31-32(30,27-19-10-6-5-7-11-19)17-9-4-3-8-14-25-20-21(23(29)22(20)28)26-18-12-15-24-16-13-18/h12-13,15-16,19,25H,2-11,14,17H2,1H3,(H,24,26)(H,27,30) |
| InChIKey | BUPDVEJLUIHHPK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|