C20H28N4O5S — CID 88876300
3-(7-morpholin-4-ylsulfonylheptylamino)-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 88876300) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 3-(7-morpholin-4-ylsulfonylheptylamino)-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(7-morpholin-4-ylsulfonylheptylamino)-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 88876300 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 3-(7-morpholin-4-ylsulfonylheptylamino)-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCCCCCCS(=O)(=O)N2CCOCC2)c(Nc2ccncc2)c1=O |
| InChI | InChI=1S/C20H28N4O5S/c25-19-17(18(20(19)26)23-16-6-9-21-10-7-16)22-8-4-2-1-3-5-15-30(27,28)24-11-13-29-14-12-24/h6-7,9-10,22H,1-5,8,11-15H2,(H,21,23) |
| InChIKey | YJCCGVALKXSUHN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|