C27H34N4O5 — CID 11533318
3-[6-[4-(2-morpholin-4-ylethoxy)phenoxy]hexylamino]-4-(pyridin-3-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 11533318) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is 3-[6-[4-(2-morpholin-4-ylethoxy)phenoxy]hexylamino]-4-(pyridin-3-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[6-[4-(2-morpholin-4-ylethoxy)phenoxy]hexylamino]-4-(pyridin-3-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11533318 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 3-[6-[4-(2-morpholin-4-ylethoxy)phenoxy]hexylamino]-4-(pyridin-3-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCCCCCOc2ccc(OCCN3CCOCC3)cc2)c(Nc2cccnc2)c1=O |
| InChI | InChI=1S/C27H34N4O5/c32-26-24(25(27(26)33)30-21-6-5-11-28-20-21)29-12-3-1-2-4-16-35-22-7-9-23(10-8-22)36-19-15-31-13-17-34-18-14-31/h5-11,20,29-30H,1-4,12-19H2 |
| InChIKey | PQMRWOHNXKTNLS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|