C22H24ClN3O3 — CID 87612561
3-[7-(4-chlorophenoxy)heptan-2-ylamino]-4-(pyridin-3-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 87612561) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 3-[7-(4-chlorophenoxy)heptan-2-ylamino]-4-(pyridin-3-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[7-(4-chlorophenoxy)heptan-2-ylamino]-4-(pyridin-3-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87612561 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-[7-(4-chlorophenoxy)heptan-2-ylamino]-4-(pyridin-3-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CC(CCCCCOc1ccc(Cl)cc1)Nc1c(Nc2cccnc2)c(=O)c1=O |
| InChI | InChI=1S/C22H24ClN3O3/c1-15(6-3-2-4-13-29-18-10-8-16(23)9-11-18)25-19-20(22(28)21(19)27)26-17-7-5-12-24-14-17/h5,7-12,14-15,25-26H,2-4,6,13H2,1H3 |
| InChIKey | GQCSLOPQWOKCNK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|