C19H17ClN4O3 — CID 10134650
3-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide (PubChem CID 10134650) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is 3-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide.
| Compound Name | 3-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 10134650 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide |
| SMILES | CCC(NC(=O)c1cccc(Cl)c1)Nc1c(Nc2cccnc2)c(=O)c1=O |
| InChI | InChI=1S/C19H17ClN4O3/c1-2-14(24-19(27)11-5-3-6-12(20)9-11)23-16-15(17(25)18(16)26)22-13-7-4-8-21-10-13/h3-10,14,22-23H,2H2,1H3,(H,24,27) |
| InChIKey | BJYFUWCTHCOUJU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|