C20H20BrN5O3 — CID 18379713
5-bromo-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]-2,2-dimethylpropyl]pyridine-3-carboxamide (PubChem CID 18379713) has the molecular formula C20H20BrN5O3 and a molecular weight of 458.32 g/mol. Its IUPAC name is 5-bromo-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]-2,2-dimethylpropyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]-2,2-dimethylpropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18379713 |
| Molecular Formula | C20H20BrN5O3 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 5-bromo-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]-2,2-dimethylpropyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)c1cncc(Br)c1)Nc1c(Nc2cccnc2)c(=O)c1=O |
| InChI | InChI=1S/C20H20BrN5O3/c1-20(2,3)19(26-18(29)11-7-12(21)9-23-8-11)25-15-14(16(27)17(15)28)24-13-5-4-6-22-10-13/h4-10,19,24-25H,1-3H3,(H,26,29) |
| InChIKey | ZCUHKKTWBUIOKW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|