About 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide
4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide (PubChem CID 10156889) has the molecular formula C19H17ClN4O3
and a molecular weight of 384.82 g/mol. Its IUPAC name is 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide |
| PubChem CID | 10156889 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide |
| SMILES | CCC(NC(=O)c1ccc(Cl)cc1)Nc1c(Nc2cccnc2)c(=O)c1=O |
| InChI | InChI=1S/C19H17ClN4O3/c1-2-14(24-19(27)11-5-7-12(20)8-6-11)23-16-15(17(25)18(16)26)22-13-4-3-9-21-10-13/h3-10,14,22-23H,2H2,1H3,(H,24,27) |
| InChIKey | OGUPDSMEAPNAML-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide?
The IUPAC name of 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide (CID 10156889) is 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide.
What is the SMILES notation for 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide?
The canonical SMILES for 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide is CCC(NC(=O)c1ccc(Cl)cc1)Nc1c(Nc2cccnc2)c(=O)c1=O.
What is the InChIKey of 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide?
The InChIKey is OGUPDSMEAPNAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN4O3/c1-2-14(24-19(27)11-5-7-12(20)8-6-11)23-16-15(17(25)18(16)26)22-13-4-3-9-21-10-13/h3-10,14,22-23H,2H2,1H3,(H,24,27).
What are the key properties of 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide?
4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide has a molecular weight of 384.82 g/mol, XLogP of 2.65, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[1-[[3,4-dioxo-2-(pyridin-3-ylamino)cyclobuten-1-yl]amino]propyl]benzamide is sourced from PubChem (CID 10156889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).