C22H23ClN4O3 — CID 10296089
N-[1-[[2-[(2-chloro-3-pyridinyl)amino]-3,4-dioxocyclobuten-1-yl]amino]-2,2-dimethylpropyl]-3-methylbenzamide (PubChem CID 10296089) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-[1-[[2-[(2-chloro-3-pyridinyl)amino]-3,4-dioxocyclobuten-1-yl]amino]-2,2-dimethylpropyl]-3-methylbenzamide.
| Compound Name | N-[1-[[2-[(2-chloro-3-pyridinyl)amino]-3,4-dioxocyclobuten-1-yl]amino]-2,2-dimethylpropyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 10296089 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[1-[[2-[(2-chloro-3-pyridinyl)amino]-3,4-dioxocyclobuten-1-yl]amino]-2,2-dimethylpropyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(Nc2c(Nc3cccnc3Cl)c(=O)c2=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H23ClN4O3/c1-12-7-5-8-13(11-12)20(30)27-21(22(2,3)4)26-16-15(17(28)18(16)29)25-14-9-6-10-24-19(14)23/h5-11,21,25-26H,1-4H3,(H,27,30) |
| InChIKey | YNIIXBAQLUVQIU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|