C24H27N3O3 — CID 11327200
3-anilino-4-[2-[4-(phenoxymethyl)piperidin-1-yl]ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 11327200) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-anilino-4-[2-[4-(phenoxymethyl)piperidin-1-yl]ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-anilino-4-[2-[4-(phenoxymethyl)piperidin-1-yl]ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11327200 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-anilino-4-[2-[4-(phenoxymethyl)piperidin-1-yl]ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCN2CCC(COc3ccccc3)CC2)c(Nc2ccccc2)c1=O |
| InChI | InChI=1S/C24H27N3O3/c28-23-21(22(24(23)29)26-19-7-3-1-4-8-19)25-13-16-27-14-11-18(12-15-27)17-30-20-9-5-2-6-10-20/h1-10,18,25-26H,11-17H2 |
| InChIKey | WJNUYPWJAJTQNP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|