C19H26N4O4S — CID 44555596
3-(pyridin-4-ylamino)-4-(6-pyrrolidin-1-ylsulfonylhexylamino)cyclobut-3-ene-1,2-dione (PubChem CID 44555596) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-(pyridin-4-ylamino)-4-(6-pyrrolidin-1-ylsulfonylhexylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(pyridin-4-ylamino)-4-(6-pyrrolidin-1-ylsulfonylhexylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 44555596 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-(pyridin-4-ylamino)-4-(6-pyrrolidin-1-ylsulfonylhexylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCCCCCS(=O)(=O)N2CCCC2)c(Nc2ccncc2)c1=O |
| InChI | InChI=1S/C19H26N4O4S/c24-18-16(17(19(18)25)22-15-7-10-20-11-8-15)21-9-3-1-2-6-14-28(26,27)23-12-4-5-13-23/h7-8,10-11,21H,1-6,9,12-14H2,(H,20,22) |
| InChIKey | NMEHEDZWBIVHKC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|